C25H23ClN2O5 — CID 172711375
3-amino-5-chloro-2-[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]-4-methylbenzoic acid (PubChem CID 172711375) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is 3-amino-5-chloro-2-[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]-4-methylbenzoic acid.
| Compound Name | 3-amino-5-chloro-2-[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 172711375 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-amino-5-chloro-2-[1-[3-(furan-3-yl)benzoyl]piperidine-3-carbonyl]-4-methylbenzoic acid |
| SMILES | Cc1c(Cl)cc(C(=O)O)c(C(=O)C2CCCN(C(=O)c3cccc(-c4ccoc4)c3)C2)c1N |
| InChI | InChI=1S/C25H23ClN2O5/c1-14-20(26)11-19(25(31)32)21(22(14)27)23(29)17-6-3-8-28(12-17)24(30)16-5-2-4-15(10-16)18-7-9-33-13-18/h2,4-5,7,9-11,13,17H,3,6,8,12,27H2,1H3,(H,31,32) |
| InChIKey | FHHPKICEUSNAJT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|