C31H26N2O7 — CID 89242167
5-[[3-formyl-4-[(2-phenoxyacetyl)amino]phenyl]methyl]-2-[(2-phenoxyacetyl)amino]benzoic acid (PubChem CID 89242167) has the molecular formula C31H26N2O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is 5-[[3-formyl-4-[(2-phenoxyacetyl)amino]phenyl]methyl]-2-[(2-phenoxyacetyl)amino]benzoic acid.
| Compound Name | 5-[[3-formyl-4-[(2-phenoxyacetyl)amino]phenyl]methyl]-2-[(2-phenoxyacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 89242167 |
| Molecular Formula | C31H26N2O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 5-[[3-formyl-4-[(2-phenoxyacetyl)amino]phenyl]methyl]-2-[(2-phenoxyacetyl)amino]benzoic acid |
| SMILES | O=Cc1cc(Cc2ccc(NC(=O)COc3ccccc3)c(C(=O)O)c2)ccc1NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C31H26N2O7/c34-18-23-16-21(11-13-27(23)32-29(35)19-39-24-7-3-1-4-8-24)15-22-12-14-28(26(17-22)31(37)38)33-30(36)20-40-25-9-5-2-6-10-25/h1-14,16-18H,15,19-20H2,(H,32,35)(H,33,36)(H,37,38) |
| InChIKey | CLXFDXBIQYVGGO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|