C25H28N4O3S — CID 112807335
N-(2,4-dimorpholin-4-ylphenyl)-2-methyl-6-thiophen-2-ylpyridine-3-carboxamide (PubChem CID 112807335) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-2-methyl-6-thiophen-2-ylpyridine-3-carboxamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-2-methyl-6-thiophen-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 112807335 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-2-methyl-6-thiophen-2-ylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccs2)ccc1C(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C25H28N4O3S/c1-18-20(5-7-22(26-18)24-3-2-16-33-24)25(30)27-21-6-4-19(28-8-12-31-13-9-28)17-23(21)29-10-14-32-15-11-29/h2-7,16-17H,8-15H2,1H3,(H,27,30) |
| InChIKey | BRKLMBIYRBUVQM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |