C16H15ClN6OS — CID 55977487
5-chloro-2-pyrrolidin-1-yl-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrimidine-4-carboxamide (PubChem CID 55977487) has the molecular formula C16H15ClN6OS and a molecular weight of 374.86 g/mol. Its IUPAC name is 5-chloro-2-pyrrolidin-1-yl-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-pyrrolidin-1-yl-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 55977487 |
| Molecular Formula | C16H15ClN6OS |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 5-chloro-2-pyrrolidin-1-yl-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cc(-c2cccs2)[nH]n1)c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C16H15ClN6OS/c17-10-9-18-16(23-5-1-2-6-23)20-14(10)15(24)19-13-8-11(21-22-13)12-4-3-7-25-12/h3-4,7-9H,1-2,5-6H2,(H2,19,21,22,24) |
| InChIKey | LNZDKDPSVMSSQZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |