C16H15BrN4OS2 — CID 31215689
N-[(2-bromophenyl)methyl]-N-methyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 31215689) has the molecular formula C16H15BrN4OS2 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-methyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N-methyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 31215689 |
| Molecular Formula | C16H15BrN4OS2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-methyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)Cn1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C16H15BrN4OS2/c1-20(9-11-5-2-3-6-12(11)17)14(22)10-21-15(18-19-16(21)23)13-7-4-8-24-13/h2-8H,9-10H2,1H3,(H,19,23) |
| InChIKey | UUESVKGCGYPWDU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|