C15H13F2NO3S — CID 27054975
N-(3,5-difluorophenyl)-4-(methylsulfonylmethyl)benzamide (PubChem CID 27054975) has the molecular formula C15H13F2NO3S and a molecular weight of 325.34 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(3,5-difluorophenyl)-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27054975 |
| Molecular Formula | C15H13F2NO3S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(3,5-difluorophenyl)-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H13F2NO3S/c1-22(20,21)9-10-2-4-11(5-3-10)15(19)18-14-7-12(16)6-13(17)8-14/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | IGMWMTZJPQHYOE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |