C25H31N3O5S — CID 43049764
N-[3-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 43049764) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[3-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 43049764 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[3-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)c2cccc(NC(=O)C3CCCO3)c2)cc1 |
| InChI | InChI=1S/C25H31N3O5S/c1-28(21-9-3-2-4-10-21)34(31,32)22-14-12-19(13-15-22)26-24(29)18-7-5-8-20(17-18)27-25(30)23-11-6-16-33-23/h5,7-8,12-15,17,21,23H,2-4,6,9-11,16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | QNCOXWFCXHBSCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |