C16H14ClN5O3S — CID 55679296
2-(4-chlorophenyl)sulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide (PubChem CID 55679296) has the molecular formula C16H14ClN5O3S and a molecular weight of 391.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55679296 |
| Molecular Formula | C16H14ClN5O3S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]acetamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)CS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H14ClN5O3S/c1-11-19-20-21-22(11)14-4-2-3-13(9-14)18-16(23)10-26(24,25)15-7-5-12(17)6-8-15/h2-9H,10H2,1H3,(H,18,23) |
| InChIKey | PMWUMBPFAXBVSX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |