C15H23ClN6O — CID 119733067
7-amino-N-[3-(5-methyltetrazol-1-yl)phenyl]heptanamide;hydrochloride (PubChem CID 119733067) has the molecular formula C15H23ClN6O and a molecular weight of 338.84 g/mol. Its IUPAC name is 7-amino-N-[3-(5-methyltetrazol-1-yl)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[3-(5-methyltetrazol-1-yl)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119733067 |
| Molecular Formula | C15H23ClN6O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 7-amino-N-[3-(5-methyltetrazol-1-yl)phenyl]heptanamide;hydrochloride |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)CCCCCCN)c1.Cl |
| InChI | InChI=1S/C15H22N6O.ClH/c1-12-18-19-20-21(12)14-8-6-7-13(11-14)17-15(22)9-4-2-3-5-10-16;/h6-8,11H,2-5,9-10,16H2,1H3,(H,17,22);1H |
| InChIKey | BFCJHGGJCXMXIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|