C17H15Cl2N5O2 — CID 55676966
2-(2,4-dichlorophenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide (PubChem CID 55676966) has the molecular formula C17H15Cl2N5O2 and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55676966 |
| Molecular Formula | C17H15Cl2N5O2 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)C(C)Oc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N5O2/c1-10(26-16-7-6-12(18)8-15(16)19)17(25)20-13-4-3-5-14(9-13)24-11(2)21-22-23-24/h3-10H,1-2H3,(H,20,25) |
| InChIKey | ZMKNJOQCXDQPER-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |