C19H20Cl2N2O3 — CID 17197387
3-[2-(2,4-dichlorophenoxy)propanoylamino]-N-propan-2-ylbenzamide (PubChem CID 17197387) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)propanoylamino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)propanoylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17197387 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)propanoylamino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(NC(=O)C(C)Oc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-11(2)22-19(25)13-5-4-6-15(9-13)23-18(24)12(3)26-17-8-7-14(20)10-16(17)21/h4-12H,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | CFOAQYZPXQZZSK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |