C21H25N5O2 — CID 55777773
2-(3-tert-butylphenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide (PubChem CID 55777773) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(3-tert-butylphenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide.
| Compound Name | 2-(3-tert-butylphenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55777773 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-(3-tert-butylphenoxy)-N-[3-(5-methyltetrazol-1-yl)phenyl]propanamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)C(C)Oc2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-14(28-19-11-6-8-16(12-19)21(3,4)5)20(27)22-17-9-7-10-18(13-17)26-15(2)23-24-25-26/h6-14H,1-5H3,(H,22,27) |
| InChIKey | MSDKQMCNKSXVFH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |