C22H28N2O3 — CID 55774306
2-(3-tert-butylphenoxy)-N-[3-(propanoylamino)phenyl]propanamide (PubChem CID 55774306) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-(3-tert-butylphenoxy)-N-[3-(propanoylamino)phenyl]propanamide.
| Compound Name | 2-(3-tert-butylphenoxy)-N-[3-(propanoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 55774306 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-(3-tert-butylphenoxy)-N-[3-(propanoylamino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)C(C)Oc2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-6-20(25)23-17-10-8-11-18(14-17)24-21(26)15(2)27-19-12-7-9-16(13-19)22(3,4)5/h7-15H,6H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | HHKPETWHWHYLFA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |