C18H27NO4 — CID 60559643
methyl 3-[2-(3-tert-butylphenoxy)propanoylamino]butanoate (PubChem CID 60559643) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[2-(3-tert-butylphenoxy)propanoylamino]butanoate.
| Compound Name | methyl 3-[2-(3-tert-butylphenoxy)propanoylamino]butanoate |
|---|---|
| PubChem CID | 60559643 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | methyl 3-[2-(3-tert-butylphenoxy)propanoylamino]butanoate |
| SMILES | COC(=O)CC(C)NC(=O)C(C)Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO4/c1-12(10-16(20)22-6)19-17(21)13(2)23-15-9-7-8-14(11-15)18(3,4)5/h7-9,11-13H,10H2,1-6H3,(H,19,21) |
| InChIKey | XFMLQUMBFGQRBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |