C19H15BrF3N3O2 — CID 55993941
1-(3-bromophenyl)-2,5-dimethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyrrole-3-carboxamide (PubChem CID 55993941) has the molecular formula C19H15BrF3N3O2 and a molecular weight of 454.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55993941 |
| Molecular Formula | C19H15BrF3N3O2 |
| Molecular Weight | 454.25 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrF3N3O2/c1-10-6-15(11(2)26(10)14-5-3-4-13(20)8-14)17(27)25-16-7-12(19(21,22)23)9-24-18(16)28/h3-9H,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | OGQONKXPMOQSDR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|