C13H10F3N3O2S — CID 66897712
3-methylsulfanyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyridine-4-carboxamide (PubChem CID 66897712) has the molecular formula C13H10F3N3O2S and a molecular weight of 329.30 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyridine-4-carboxamide.
| Compound Name | 3-methylsulfanyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66897712 |
| Molecular Formula | C13H10F3N3O2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-methylsulfanyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pyridine-4-carboxamide |
| SMILES | CSc1cnccc1C(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C13H10F3N3O2S/c1-22-10-6-17-3-2-8(10)11(20)19-9-4-7(13(14,15)16)5-18-12(9)21/h2-6H,1H3,(H,18,21)(H,19,20) |
| InChIKey | XHIWEFLHNBCPLX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |