C12H12BrFN2O2S — CID 107533709
2-bromo-4-[(1,1-dioxothian-3-yl)amino]-3-fluorobenzonitrile (PubChem CID 107533709) has the molecular formula C12H12BrFN2O2S and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-bromo-4-[(1,1-dioxothian-3-yl)amino]-3-fluorobenzonitrile.
| Compound Name | 2-bromo-4-[(1,1-dioxothian-3-yl)amino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533709 |
| Molecular Formula | C12H12BrFN2O2S |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 2-bromo-4-[(1,1-dioxothian-3-yl)amino]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(NC2CCCS(=O)(=O)C2)c(F)c1Br |
| InChI | InChI=1S/C12H12BrFN2O2S/c13-11-8(6-15)3-4-10(12(11)14)16-9-2-1-5-19(17,18)7-9/h3-4,9,16H,1-2,5,7H2 |
| InChIKey | AIWXSJZLSQLSMD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |