C15H18BrFN2 — CID 107533085
2-bromo-4-[(2,3-dimethylcyclohexyl)amino]-3-fluorobenzonitrile (PubChem CID 107533085) has the molecular formula C15H18BrFN2 and a molecular weight of 325.23 g/mol. Its IUPAC name is 2-bromo-4-[(2,3-dimethylcyclohexyl)amino]-3-fluorobenzonitrile.
| Compound Name | 2-bromo-4-[(2,3-dimethylcyclohexyl)amino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533085 |
| Molecular Formula | C15H18BrFN2 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-bromo-4-[(2,3-dimethylcyclohexyl)amino]-3-fluorobenzonitrile |
| SMILES | CC1CCCC(Nc2ccc(C#N)c(Br)c2F)C1C |
| InChI | InChI=1S/C15H18BrFN2/c1-9-4-3-5-12(10(9)2)19-13-7-6-11(8-18)14(16)15(13)17/h6-7,9-10,12,19H,3-5H2,1-2H3 |
| InChIKey | WOAGYWHJAJZRAW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |