C14H19ClFN — CID 64774574
3-chloro-N-(2,3-dimethylcyclohexyl)-2-fluoroaniline (PubChem CID 64774574) has the molecular formula C14H19ClFN and a molecular weight of 255.76 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dimethylcyclohexyl)-2-fluoroaniline.
| Compound Name | 3-chloro-N-(2,3-dimethylcyclohexyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 64774574 |
| Molecular Formula | C14H19ClFN |
| Molecular Weight | 255.76 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-chloro-N-(2,3-dimethylcyclohexyl)-2-fluoroaniline |
| SMILES | CC1CCCC(Nc2cccc(Cl)c2F)C1C |
| InChI | InChI=1S/C14H19ClFN/c1-9-5-3-7-12(10(9)2)17-13-8-4-6-11(15)14(13)16/h4,6,8-10,12,17H,3,5,7H2,1-2H3 |
| InChIKey | YMDURKGCZSFOOR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |