C14H19ClIN — CID 107631533
4-chloro-N-(2,3-dimethylcyclohexyl)-2-iodoaniline (PubChem CID 107631533) has the molecular formula C14H19ClIN and a molecular weight of 363.67 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dimethylcyclohexyl)-2-iodoaniline.
| Compound Name | 4-chloro-N-(2,3-dimethylcyclohexyl)-2-iodoaniline |
|---|---|
| PubChem CID | 107631533 |
| Molecular Formula | C14H19ClIN |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 4-chloro-N-(2,3-dimethylcyclohexyl)-2-iodoaniline |
| SMILES | CC1CCCC(Nc2ccc(Cl)cc2I)C1C |
| InChI | InChI=1S/C14H19ClIN/c1-9-4-3-5-13(10(9)2)17-14-7-6-11(15)8-12(14)16/h6-10,13,17H,3-5H2,1-2H3 |
| InChIKey | JBXHMMKGWFNUEJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|