C14H17ClN2 — CID 64908917
5-chloro-2-[(2,3-dimethylcyclopentyl)amino]benzonitrile (PubChem CID 64908917) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-chloro-2-[(2,3-dimethylcyclopentyl)amino]benzonitrile.
| Compound Name | 5-chloro-2-[(2,3-dimethylcyclopentyl)amino]benzonitrile |
|---|---|
| PubChem CID | 64908917 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-chloro-2-[(2,3-dimethylcyclopentyl)amino]benzonitrile |
| SMILES | CC1CCC(Nc2ccc(Cl)cc2C#N)C1C |
| InChI | InChI=1S/C14H17ClN2/c1-9-3-5-13(10(9)2)17-14-6-4-12(15)7-11(14)8-16/h4,6-7,9-10,13,17H,3,5H2,1-2H3 |
| InChIKey | YTSPGFWADPPMCC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |