C15H17ClN2O — CID 133364808
2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-5-chlorobenzonitrile (PubChem CID 133364808) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-5-chlorobenzonitrile.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 133364808 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1NC1CCCC2OCCC12 |
| InChI | InChI=1S/C15H17ClN2O/c16-11-4-5-13(10(8-11)9-17)18-14-2-1-3-15-12(14)6-7-19-15/h4-5,8,12,14-15,18H,1-3,6-7H2 |
| InChIKey | CQQUKYHAZKIKNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |