C13H13ClN2O — CID 80601498
4-chloro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzonitrile (PubChem CID 80601498) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 4-chloro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzonitrile.
| Compound Name | 4-chloro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 80601498 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 4-chloro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NC1CC2CCC1O2 |
| InChI | InChI=1S/C13H13ClN2O/c14-9-2-1-8(7-15)11(5-9)16-12-6-10-3-4-13(12)17-10/h1-2,5,10,12-13,16H,3-4,6H2 |
| InChIKey | KOHYHPQFOZXWFC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |