C14H19BrClN — CID 64761795
4-bromo-2-chloro-N-(2,3-dimethylcyclohexyl)aniline (PubChem CID 64761795) has the molecular formula C14H19BrClN and a molecular weight of 316.67 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2,3-dimethylcyclohexyl)aniline.
| Compound Name | 4-bromo-2-chloro-N-(2,3-dimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 64761795 |
| Molecular Formula | C14H19BrClN |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-bromo-2-chloro-N-(2,3-dimethylcyclohexyl)aniline |
| SMILES | CC1CCCC(Nc2ccc(Br)cc2Cl)C1C |
| InChI | InChI=1S/C14H19BrClN/c1-9-4-3-5-13(10(9)2)17-14-7-6-11(15)8-12(14)16/h6-10,13,17H,3-5H2,1-2H3 |
| InChIKey | LYCDZXGLJJBQSR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |