C14H18ClFN2S — CID 8788556
1-(3-chloro-2-fluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8788556) has the molecular formula C14H18ClFN2S and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8788556 |
| Molecular Formula | C14H18ClFN2S |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C14H18ClFN2S/c1-9-5-2-3-7-11(9)17-14(19)18-12-8-4-6-10(15)13(12)16/h4,6,8-9,11H,2-3,5,7H2,1H3,(H2,17,18,19)/t9-,11+/m0/s1 |
| InChIKey | QCOAJVIJBWEBAO-GXSJLCMTSA-N |
| XLogP | 4.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|