C16H23ClN2S — CID 11920775
1-(3-chloro-2-methylphenyl)-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11920775) has the molecular formula C16H23ClN2S and a molecular weight of 310.89 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11920775 |
| Molecular Formula | C16H23ClN2S |
| Molecular Weight | 310.89 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N[C@@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C16H23ClN2S/c1-10-6-4-8-14(11(10)2)18-16(20)19-15-9-5-7-13(17)12(15)3/h5,7,9-11,14H,4,6,8H2,1-3H3,(H2,18,19,20)/t10-,11-,14+/m0/s1 |
| InChIKey | DPYRJFZIQUZJST-COPLHBTASA-N |
| XLogP | 4.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|