C15H23NO — CID 64762855
[2-[(2,3-dimethylcyclohexyl)amino]phenyl]methanol (PubChem CID 64762855) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]phenyl]methanol.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 64762855 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]phenyl]methanol |
| SMILES | CC1CCCC(Nc2ccccc2CO)C1C |
| InChI | InChI=1S/C15H23NO/c1-11-6-5-9-14(12(11)2)16-15-8-4-3-7-13(15)10-17/h3-4,7-8,11-12,14,16-17H,5-6,9-10H2,1-2H3 |
| InChIKey | NOFHGFZHQBIXOJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |