C12H14N2O3S — CID 107467134
2-[(1,1-dioxothiolan-3-yl)amino]-3-methoxybenzonitrile (PubChem CID 107467134) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-3-methoxybenzonitrile.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107467134 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N2O3S/c1-17-11-4-2-3-9(7-13)12(11)14-10-5-6-18(15,16)8-10/h2-4,10,14H,5-6,8H2,1H3 |
| InChIKey | ZQDSKHGMCCSFOC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |