C15H20N2O3S — CID 107467482
3-methoxy-2-[(3-methylsulfonylcyclohexyl)amino]benzonitrile (PubChem CID 107467482) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-methoxy-2-[(3-methylsulfonylcyclohexyl)amino]benzonitrile.
| Compound Name | 3-methoxy-2-[(3-methylsulfonylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107467482 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-methoxy-2-[(3-methylsulfonylcyclohexyl)amino]benzonitrile |
| SMILES | COc1cccc(C#N)c1NC1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-20-14-8-3-5-11(10-16)15(14)17-12-6-4-7-13(9-12)21(2,18)19/h3,5,8,12-13,17H,4,6-7,9H2,1-2H3 |
| InChIKey | FMGSPSHNQMMTBO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |