C9H10N4O2S — CID 62671449
3-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carbonitrile (PubChem CID 62671449) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carbonitrile.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62671449 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10N4O2S/c10-5-8-9(12-3-2-11-8)13-7-1-4-16(14,15)6-7/h2-3,7H,1,4,6H2,(H,12,13) |
| InChIKey | MWAKHKKKJKQZNM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |