C17H16N6 — CID 133284387
3-[[1-(4-cyanophenyl)piperidin-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 133284387) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-[[1-(4-cyanophenyl)piperidin-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[1-(4-cyanophenyl)piperidin-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284387 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[[1-(4-cyanophenyl)piperidin-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(Nc3nccnc3C#N)CC2)cc1 |
| InChI | InChI=1S/C17H16N6/c18-11-13-1-3-15(4-2-13)23-9-5-14(6-10-23)22-17-16(12-19)20-7-8-21-17/h1-4,7-8,14H,5-6,9-10H2,(H,21,22) |
| InChIKey | NEABFLUSRQKLOK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |