C13H17N5 — CID 62673247
3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrazine-2-carbonitrile (PubChem CID 62673247) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62673247 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C13H17N5/c14-9-11-13(16-6-5-15-11)17-10-4-8-18-7-2-1-3-12(10)18/h5-6,10,12H,1-4,7-8H2,(H,16,17) |
| InChIKey | SWIVGGSUXMXIKI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |