C12H16Cl2N4 — CID 79632398
N-(2,5-dichloropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 79632398) has the molecular formula C12H16Cl2N4 and a molecular weight of 287.19 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 79632398 |
| Molecular Formula | C12H16Cl2N4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | Clc1ncc(Cl)c(NC2CCN3CCCCC23)n1 |
| InChI | InChI=1S/C12H16Cl2N4/c13-8-7-15-12(14)17-11(8)16-9-4-6-18-5-2-1-3-10(9)18/h7,9-10H,1-6H2,(H,15,16,17) |
| InChIKey | HEPFXWPPRKBZIV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |