C16H15F3N6 — CID 133283191
3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 133283191) has the molecular formula C16H15F3N6 and a molecular weight of 348.33 g/mol. Its IUPAC name is 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133283191 |
| Molecular Formula | C16H15F3N6 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H15F3N6/c17-16(18,19)11-1-2-14(23-10-11)25-7-3-12(4-8-25)24-15-13(9-20)21-5-6-22-15/h1-2,5-6,10,12H,3-4,7-8H2,(H,22,24) |
| InChIKey | FNGYHMWBNWVYFN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |