C9H12BrN3O3S — CID 137015423
5-bromo-4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one (PubChem CID 137015423) has the molecular formula C9H12BrN3O3S and a molecular weight of 322.18 g/mol. Its IUPAC name is 5-bromo-4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137015423 |
| Molecular Formula | C9H12BrN3O3S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 5-bromo-4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCS(=O)(=O)CC2)c1Br |
| InChI | InChI=1S/C9H12BrN3O3S/c10-7-8(11-5-12-9(7)14)13-6-1-3-17(15,16)4-2-6/h5-6H,1-4H2,(H2,11,12,13,14) |
| InChIKey | OLIBWELHELBVMF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |