C8H10ClN3O — CID 136975373
5-chloro-4-(cyclobutylamino)-1H-pyrimidin-6-one (PubChem CID 136975373) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 5-chloro-4-(cyclobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(cyclobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975373 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 5-chloro-4-(cyclobutylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCC2)c1Cl |
| InChI | InChI=1S/C8H10ClN3O/c9-6-7(10-4-11-8(6)13)12-5-2-1-3-5/h4-5H,1-3H2,(H2,10,11,12,13) |
| InChIKey | KXKYQJJFQZLEAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |