C7H9ClN4O — CID 136977546
4-[(2-aminocyclopropyl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136977546) has the molecular formula C7H9ClN4O and a molecular weight of 200.63 g/mol. Its IUPAC name is 4-[(2-aminocyclopropyl)amino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-aminocyclopropyl)amino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977546 |
| Molecular Formula | C7H9ClN4O |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 4-[(2-aminocyclopropyl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | NC1CC1Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C7H9ClN4O/c8-5-6(10-2-11-7(5)13)12-4-1-3(4)9/h2-4H,1,9H2,(H2,10,11,12,13) |
| InChIKey | HEEJGRVDIHJKAK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |