C12H19ClN4O — CID 136980157
4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136980157) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136980157 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-[[4-(aminomethyl)cyclohexyl]methylamino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | NCC1CCC(CNc2nc[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C12H19ClN4O/c13-10-11(16-7-17-12(10)18)15-6-9-3-1-8(5-14)2-4-9/h7-9H,1-6,14H2,(H2,15,16,17,18) |
| InChIKey | JUAURFRUDVIBQO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |