C6H9ClN4O — CID 136976649
5-chloro-4-(2,2-dimethylhydrazinyl)-1H-pyrimidin-6-one (PubChem CID 136976649) has the molecular formula C6H9ClN4O and a molecular weight of 188.62 g/mol. Its IUPAC name is 5-chloro-4-(2,2-dimethylhydrazinyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,2-dimethylhydrazinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976649 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 5-chloro-4-(2,2-dimethylhydrazinyl)-1H-pyrimidin-6-one |
| SMILES | CN(C)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C6H9ClN4O/c1-11(2)10-5-4(7)6(12)9-3-8-5/h3H,1-2H3,(H2,8,9,10,12) |
| InChIKey | XMEGFASXVRMCSC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.62 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|