About 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one
5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one (PubChem CID 136971427) has the molecular formula C11H11ClN4O
and a molecular weight of 250.69 g/mol. Its IUPAC name is 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136971427 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Nc2nc[nH]c(=O)c2Cl)c(C)n1 |
| InChI | InChI=1S/C11H11ClN4O/c1-6-3-4-8(7(2)15-6)16-10-9(12)11(17)14-5-13-10/h3-5H,1-2H3,(H2,13,14,16,17) |
| InChIKey | IGOXGQVZXDEELE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one (CID 136971427) is 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one is Cc1ccc(Nc2nc[nH]c(=O)c2Cl)c(C)n1.
What is the InChIKey of 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one?
The InChIKey is IGOXGQVZXDEELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4O/c1-6-3-4-8(7(2)15-6)16-10-9(12)11(17)14-5-13-10/h3-5H,1-2H3,(H2,13,14,16,17).
What are the key properties of 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one?
5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one has a molecular weight of 250.69 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[(2,6-dimethyl-3-pyridinyl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136971427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).