C11H9ClFN3O — CID 136970408
5-chloro-4-(2-fluoro-5-methylanilino)-1H-pyrimidin-6-one (PubChem CID 136970408) has the molecular formula C11H9ClFN3O and a molecular weight of 253.66 g/mol. Its IUPAC name is 5-chloro-4-(2-fluoro-5-methylanilino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2-fluoro-5-methylanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970408 |
| Molecular Formula | C11H9ClFN3O |
| Molecular Weight | 253.66 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-chloro-4-(2-fluoro-5-methylanilino)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(F)c(Nc2nc[nH]c(=O)c2Cl)c1 |
| InChI | InChI=1S/C11H9ClFN3O/c1-6-2-3-7(13)8(4-6)16-10-9(12)11(17)15-5-14-10/h2-5H,1H3,(H2,14,15,16,17) |
| InChIKey | ODDWKJAQKBQEMR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |