C11H8ClF2N3OS — CID 136970449
5-chloro-4-[2-(difluoromethylsulfanyl)anilino]-1H-pyrimidin-6-one (PubChem CID 136970449) has the molecular formula C11H8ClF2N3OS and a molecular weight of 303.72 g/mol. Its IUPAC name is 5-chloro-4-[2-(difluoromethylsulfanyl)anilino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(difluoromethylsulfanyl)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970449 |
| Molecular Formula | C11H8ClF2N3OS |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 5-chloro-4-[2-(difluoromethylsulfanyl)anilino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(Nc2ccccc2SC(F)F)c1Cl |
| InChI | InChI=1S/C11H8ClF2N3OS/c12-8-9(15-5-16-10(8)18)17-6-3-1-2-4-7(6)19-11(13)14/h1-5,11H,(H2,15,16,17,18) |
| InChIKey | CWCCEJLOHMKTCZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |