C14H21N3O3S — CID 61102706
5-amino-2-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide (PubChem CID 61102706) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 5-amino-2-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide.
| Compound Name | 5-amino-2-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 61102706 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-amino-2-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
| SMILES | CN(C)c1ccc(N)cc1C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-16(2)13-5-4-10(15)8-12(13)14(18)17(3)11-6-7-21(19,20)9-11/h4-5,8,11H,6-7,9,15H2,1-3H3 |
| InChIKey | WMYLQVVTIKEESL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|