C12H17NO4S — CID 43053942
N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethylfuran-3-carboxamide (PubChem CID 43053942) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 43053942 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C2CCS(=O)(=O)C2)c(C)o1 |
| InChI | InChI=1S/C12H17NO4S/c1-8-6-11(9(2)17-8)12(14)13(3)10-4-5-18(15,16)7-10/h6,10H,4-5,7H2,1-3H3 |
| InChIKey | LYFIJIBNEAEOCK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |