C16H22N2O7S — CID 8537615
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-methoxy-2-nitrophenoxy)-N-propylacetamide (PubChem CID 8537615) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-methoxy-2-nitrophenoxy)-N-propylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-methoxy-2-nitrophenoxy)-N-propylacetamide |
|---|---|
| PubChem CID | 8537615 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-methoxy-2-nitrophenoxy)-N-propylacetamide |
| SMILES | CCCN(C(=O)COc1ccc(OC)cc1[N+](=O)[O-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O7S/c1-3-7-17(12-6-8-26(22,23)11-12)16(19)10-25-15-5-4-13(24-2)9-14(15)18(20)21/h4-5,9,12H,3,6-8,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | OSCLDWCESCOEFW-LBPRGKRZSA-N |
| XLogP | 1.41 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|