C19H26N2O9S — CID 4306154
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 4306154) has the molecular formula C19H26N2O9S and a molecular weight of 458.49 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 4306154 |
| Molecular Formula | C19H26N2O9S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N(CC(C)C)C2CCS(=O)(=O)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H26N2O9S/c1-12(2)9-20(13-5-6-31(26,27)11-13)18(22)10-30-19(23)14-7-16(28-3)17(29-4)8-15(14)21(24)25/h7-8,12-13H,5-6,9-11H2,1-4H3 |
| InChIKey | ZDKYDIMXPMAPLP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|