C15H20N2O8S — CID 2551006
[2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2551006) has the molecular formula C15H20N2O8S and a molecular weight of 388.40 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2551006 |
| Molecular Formula | C15H20N2O8S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1ccc([N+](=O)[O-])o1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O8S/c1-10(2)7-16(11-5-6-26(22,23)9-11)13(18)8-24-15(19)12-3-4-14(25-12)17(20)21/h3-4,10-11H,5-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | GNRBQXQQQGUEOQ-LLVKDONJSA-N |
| XLogP | 1.02 |
| TPSA | 137.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|