C18H24N2O7S2 — CID 55462733
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 5-methylsulfanyl-2-nitrobenzoate (PubChem CID 55462733) has the molecular formula C18H24N2O7S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 5-methylsulfanyl-2-nitrobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 5-methylsulfanyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 55462733 |
| Molecular Formula | C18H24N2O7S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 5-methylsulfanyl-2-nitrobenzoate |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)OCC(=O)N(CC(C)C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H24N2O7S2/c1-12(2)9-19(13-6-7-29(25,26)11-13)17(21)10-27-18(22)15-8-14(28-3)4-5-16(15)20(23)24/h4-5,8,12-13H,6-7,9-11H2,1-3H3 |
| InChIKey | GMRNHAVOQQXIQX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|