C19H24N2O9S — CID 3888411
3-O-[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 3888411) has the molecular formula C19H24N2O9S and a molecular weight of 456.47 g/mol. Its IUPAC name is 3-O-[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3888411 |
| Molecular Formula | C19H24N2O9S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-O-[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)N(CC(C)C)C2CCS(=O)(=O)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N2O9S/c1-12(2)9-20(15-4-5-31(27,28)11-15)17(22)10-30-19(24)14-6-13(18(23)29-3)7-16(8-14)21(25)26/h6-8,12,15H,4-5,9-11H2,1-3H3 |
| InChIKey | FVUKQZGRPXGGRC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|