C23H26N2O8S — CID 51925116
[(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate (PubChem CID 51925116) has the molecular formula C23H26N2O8S and a molecular weight of 490.53 g/mol. Its IUPAC name is [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 51925116 |
| Molecular Formula | C23H26N2O8S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccc(C(=O)O[C@H](C)C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H26N2O8S/c1-16-7-10-19(25(28)29)15-21(16)34(30,31)33-20-11-8-18(9-12-20)23(27)32-17(2)22(26)24-13-5-3-4-6-14-24/h7-12,15,17H,3-6,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | BHIJAGDPIAXNOV-QGZVFWFLSA-N |
| XLogP | 3.62 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|